C12H12F3N3O — CID 63019469
3,4-dimethyl-5-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 63019469) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is 3,4-dimethyl-5-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3,4-dimethyl-5-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 63019469 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3,4-dimethyl-5-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Cc1cc(N)cc(-c2nc(CC(F)(F)F)no2)c1C |
| InChI | InChI=1S/C12H12F3N3O/c1-6-3-8(16)4-9(7(6)2)11-17-10(18-19-11)5-12(13,14)15/h3-4H,5,16H2,1-2H3 |
| InChIKey | YBJJIXAZVHAJBS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|