About 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid
2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid (PubChem CID 63019602) has the molecular formula C12H10FNO4S2
and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid.
Molecular Properties
| Compound Name | 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid |
| PubChem CID | 63019602 |
| Molecular Formula | C12H10FNO4S2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid |
| SMILES | Cc1ncc(CS(=O)(=O)c2ccc(F)c(C(=O)O)c2)s1 |
| InChI | InChI=1S/C12H10FNO4S2/c1-7-14-5-8(19-7)6-20(17,18)9-2-3-11(13)10(4-9)12(15)16/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | PPBHOZGVAJQKNJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid?
The IUPAC name of 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid (CID 63019602) is 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid.
What is the SMILES notation for 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid?
The canonical SMILES for 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid is Cc1ncc(CS(=O)(=O)c2ccc(F)c(C(=O)O)c2)s1.
What is the InChIKey of 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid?
The InChIKey is PPBHOZGVAJQKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO4S2/c1-7-14-5-8(19-7)6-20(17,18)9-2-3-11(13)10(4-9)12(15)16/h2-5H,6H2,1H3,(H,15,16).
What are the key properties of 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid?
2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid has a molecular weight of 315.35 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-[(2-methyl-1,3-thiazol-5-yl)methylsulfonyl]benzoic acid is sourced from PubChem (CID 63019602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).