About 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid
3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid (PubChem CID 63019605) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid |
| PubChem CID | 63019605 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid |
| SMILES | Cc1ncc(CN(CCC(=O)O)C(C)C)s1 |
| InChI | InChI=1S/C11H18N2O2S/c1-8(2)13(5-4-11(14)15)7-10-6-12-9(3)16-10/h6,8H,4-5,7H2,1-3H3,(H,14,15) |
| InChIKey | BSIPZDOAFVPPQW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid?
The IUPAC name of 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid (CID 63019605) is 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid.
What is the SMILES notation for 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid?
The canonical SMILES for 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid is Cc1ncc(CN(CCC(=O)O)C(C)C)s1.
What is the InChIKey of 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid?
The InChIKey is BSIPZDOAFVPPQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-8(2)13(5-4-11(14)15)7-10-6-12-9(3)16-10/h6,8H,4-5,7H2,1-3H3,(H,14,15).
What are the key properties of 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid?
3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid has a molecular weight of 242.34 g/mol, XLogP of 2.14, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanoic acid is sourced from PubChem (CID 63019605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).