C16H22N2O3 — CID 63020173
5-[[2-(cyclopentylamino)acetyl]amino]-2,3-dimethylbenzoic acid (PubChem CID 63020173) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 5-[[2-(cyclopentylamino)acetyl]amino]-2,3-dimethylbenzoic acid.
| Compound Name | 5-[[2-(cyclopentylamino)acetyl]amino]-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 63020173 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 5-[[2-(cyclopentylamino)acetyl]amino]-2,3-dimethylbenzoic acid |
| SMILES | Cc1cc(NC(=O)CNC2CCCC2)cc(C(=O)O)c1C |
| InChI | InChI=1S/C16H22N2O3/c1-10-7-13(8-14(11(10)2)16(20)21)18-15(19)9-17-12-5-3-4-6-12/h7-8,12,17H,3-6,9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | ONJBBIBRYJQDDQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |