C15H16N2O4 — CID 63020239
N-[1,3-dihydro-2-benzofuran-5-yl-(5-nitrofuran-2-yl)methyl]ethanamine (PubChem CID 63020239) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is N-[1,3-dihydro-2-benzofuran-5-yl-(5-nitrofuran-2-yl)methyl]ethanamine.
| Compound Name | N-[1,3-dihydro-2-benzofuran-5-yl-(5-nitrofuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 63020239 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[1,3-dihydro-2-benzofuran-5-yl-(5-nitrofuran-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc2c(c1)COC2)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C15H16N2O4/c1-2-16-15(13-5-6-14(21-13)17(18)19)10-3-4-11-8-20-9-12(11)7-10/h3-7,15-16H,2,8-9H2,1H3 |
| InChIKey | SPXLMGLOWGCXNI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|