C11H9F5O2 — CID 63020265
1-(1,3-dihydro-2-benzofuran-5-yl)-2,2,3,3,3-pentafluoropropan-1-ol (PubChem CID 63020265) has the molecular formula C11H9F5O2 and a molecular weight of 268.18 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)-2,2,3,3,3-pentafluoropropan-1-ol.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-2,2,3,3,3-pentafluoropropan-1-ol |
|---|---|
| PubChem CID | 63020265 |
| Molecular Formula | C11H9F5O2 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-2,2,3,3,3-pentafluoropropan-1-ol |
| SMILES | OC(c1ccc2c(c1)COC2)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F5O2/c12-10(13,11(14,15)16)9(17)6-1-2-7-4-18-5-8(7)3-6/h1-3,9,17H,4-5H2 |
| InChIKey | VJPKKCZUKQMXRS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|