C30H28N2O7S — CID 6302040
(4E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 6302040) has the molecular formula C30H28N2O7S and a molecular weight of 560.63 g/mol. Its IUPAC name is (4E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6302040 |
| Molecular Formula | C30H28N2O7S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | (4E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(OCC)cc4s3)C2c2ccc(O)c(OC)c2)c1 |
| InChI | InChI=1S/C30H28N2O7S/c1-4-13-39-19-8-6-7-18(14-19)27(34)25-26(17-9-12-22(33)23(15-17)37-3)32(29(36)28(25)35)30-31-21-11-10-20(38-5-2)16-24(21)40-30/h6-12,14-16,26,33-34H,4-5,13H2,1-3H3/b27-25+ |
| InChIKey | KHFOAPJAVWUETR-IMVLJIQESA-N |
| XLogP | 5.82 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|