C21H20N2OS — CID 630212
2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl)-1-(4-phenylphenyl)ethanone (PubChem CID 630212) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl)-1-(4-phenylphenyl)ethanone.
| Compound Name | 2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl)-1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 630212 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl)-1-(4-phenylphenyl)ethanone |
| SMILES | [H]/N=c1\sc2c(n1CC(=O)c1ccc(-c3ccccc3)cc1)CCCC2 |
| InChI | InChI=1S/C21H20N2OS/c22-21-23(18-8-4-5-9-20(18)25-21)14-19(24)17-12-10-16(11-13-17)15-6-2-1-3-7-15/h1-3,6-7,10-13,22H,4-5,8-9,14H2/b22-21- |
| InChIKey | CKZFNQNLNCLHNJ-DQRAZIAOSA-N |
| XLogP | 4.46 |
| TPSA | 45.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|