About 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran
5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran (PubChem CID 63021319) has the molecular formula C17H17BrO
and a molecular weight of 317.23 g/mol. Its IUPAC name is 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran |
| PubChem CID | 63021319 |
| Molecular Formula | C17H17BrO |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran |
| SMILES | Cc1cccc(C(Br)c2ccc3c(c2)COC3)c1C |
| InChI | InChI=1S/C17H17BrO/c1-11-4-3-5-16(12(11)2)17(18)13-6-7-14-9-19-10-15(14)8-13/h3-8,17H,9-10H2,1-2H3 |
| InChIKey | OPAAZYPUVQASNA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran?
The IUPAC name of 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran (CID 63021319) is 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran?
The canonical SMILES for 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran is Cc1cccc(C(Br)c2ccc3c(c2)COC3)c1C.
What is the InChIKey of 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran?
The InChIKey is OPAAZYPUVQASNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrO/c1-11-4-3-5-16(12(11)2)17(18)13-6-7-14-9-19-10-15(14)8-13/h3-8,17H,9-10H2,1-2H3.
What are the key properties of 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran?
5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran has a molecular weight of 317.23 g/mol, XLogP of 4.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bromo-(2,3-dimethylphenyl)methyl]-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 63021319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).