About 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine
6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine (PubChem CID 63021346) has the molecular formula C10H11N3S2
and a molecular weight of 237.35 g/mol. Its IUPAC name is 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine |
| PubChem CID | 63021346 |
| Molecular Formula | C10H11N3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine |
| SMILES | Cc1ncc(CSc2ccc(N)cn2)s1 |
| InChI | InChI=1S/C10H11N3S2/c1-7-12-5-9(15-7)6-14-10-3-2-8(11)4-13-10/h2-5H,6,11H2,1H3 |
| InChIKey | OSFIWGASOWDSHA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine?
The IUPAC name of 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine (CID 63021346) is 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine.
What is the SMILES notation for 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine?
The canonical SMILES for 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine is Cc1ncc(CSc2ccc(N)cn2)s1.
What is the InChIKey of 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine?
The InChIKey is OSFIWGASOWDSHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3S2/c1-7-12-5-9(15-7)6-14-10-3-2-8(11)4-13-10/h2-5H,6,11H2,1H3.
What are the key properties of 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine?
6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine has a molecular weight of 237.35 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]pyridin-3-amine is sourced from PubChem (CID 63021346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).