C10H13N5 — CID 63021563
5-(5-amino-2,3-dimethylphenyl)-1H-1,2,4-triazol-3-amine (PubChem CID 63021563) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-(5-amino-2,3-dimethylphenyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(5-amino-2,3-dimethylphenyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 63021563 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 5-(5-amino-2,3-dimethylphenyl)-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1cc(N)cc(-c2nc(N)n[nH]2)c1C |
| InChI | InChI=1S/C10H13N5/c1-5-3-7(11)4-8(6(5)2)9-13-10(12)15-14-9/h3-4H,11H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | NOOWLRYBBYPYEZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|