2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid

C9H12N2O4S — CID 63023024

IUPAC2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid
SMILESCOCCN(CC(=O)O)C(=O)c1cscn1
InChIInChI=1S/C9H12N2O4S/c1-15-3-2-11(4-8(12)13)9(14)7-5-16-6-10-7/h5-6H,2-4H2,1H3,(H,12,13)
InChIKeyAQFJSUQSYIWPCC-UHFFFAOYSA-N
MW244.27 g/mol
LogP0.32
Rot. Bonds6

About 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid

2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid (PubChem CID 63023024) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid.

Molecular Properties

Compound Name2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid
PubChem CID63023024
Molecular FormulaC9H12N2O4S
Molecular Weight244.27 g/mol
Exact Mass244.05
IUPAC Name2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid
SMILESCOCCN(CC(=O)O)C(=O)c1cscn1
InChIInChI=1S/C9H12N2O4S/c1-15-3-2-11(4-8(12)13)9(14)7-5-16-6-10-7/h5-6H,2-4H2,1H3,(H,12,13)
InChIKeyAQFJSUQSYIWPCC-UHFFFAOYSA-N
XLogP0.32
TPSA79.73 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.27
LogP ≤ 50.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid?
The IUPAC name of 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid (CID 63023024) is 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid is COCCN(CC(=O)O)C(=O)c1cscn1.
What is the InChIKey of 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid?
The InChIKey is AQFJSUQSYIWPCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4S/c1-15-3-2-11(4-8(12)13)9(14)7-5-16-6-10-7/h5-6H,2-4H2,1H3,(H,12,13).
What are the key properties of 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid?
2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid has a molecular weight of 244.27 g/mol, XLogP of 0.32, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-methoxyethyl(1,3-thiazole-4-carbonyl)amino]acetic acid is sourced from PubChem (CID 63023024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).