C15H11F5N2O — CID 630231
2,2,3,3,3-pentafluoro-1-(2'-methylidenespiro[indole-3,3'-pyrrolidine]-1'-yl)propan-1-one (PubChem CID 630231) has the molecular formula C15H11F5N2O and a molecular weight of 330.26 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(2'-methylidenespiro[indole-3,3'-pyrrolidine]-1'-yl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(2'-methylidenespiro[indole-3,3'-pyrrolidine]-1'-yl)propan-1-one |
|---|---|
| PubChem CID | 630231 |
| Molecular Formula | C15H11F5N2O |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(2'-methylidenespiro[indole-3,3'-pyrrolidine]-1'-yl)propan-1-one |
| SMILES | C=C1N(C(=O)C(F)(F)C(F)(F)F)CCC12C=Nc1ccccc12 |
| InChI | InChI=1S/C15H11F5N2O/c1-9-13(8-21-11-5-3-2-4-10(11)13)6-7-22(9)12(23)14(16,17)15(18,19)20/h2-5,8H,1,6-7H2 |
| InChIKey | WFTZFKLGORVGHF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|