About N-prop-2-ynyl-1,3-thiazole-4-carboxamide
N-prop-2-ynyl-1,3-thiazole-4-carboxamide (PubChem CID 63024101) has the molecular formula C7H6N2OS
and a molecular weight of 166.21 g/mol. Its IUPAC name is N-prop-2-ynyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-prop-2-ynyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 63024101 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | N-prop-2-ynyl-1,3-thiazole-4-carboxamide |
| SMILES | C#CCNC(=O)c1cscn1 |
| InChI | InChI=1S/C7H6N2OS/c1-2-3-8-7(10)6-4-11-5-9-6/h1,4-5H,3H2,(H,8,10) |
| InChIKey | SMTQVWXAFNKUGU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-ynyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-ynyl-1,3-thiazole-4-carboxamide?
The IUPAC name of N-prop-2-ynyl-1,3-thiazole-4-carboxamide (CID 63024101) is N-prop-2-ynyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-prop-2-ynyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-prop-2-ynyl-1,3-thiazole-4-carboxamide is C#CCNC(=O)c1cscn1.
What is the InChIKey of N-prop-2-ynyl-1,3-thiazole-4-carboxamide?
The InChIKey is SMTQVWXAFNKUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c1-2-3-8-7(10)6-4-11-5-9-6/h1,4-5H,3H2,(H,8,10).
What are the key properties of N-prop-2-ynyl-1,3-thiazole-4-carboxamide?
N-prop-2-ynyl-1,3-thiazole-4-carboxamide has a molecular weight of 166.21 g/mol, XLogP of 0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-ynyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 63024101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).