About 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine
7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 63024843) has the molecular formula C11H18N4O2S
and a molecular weight of 270.36 g/mol. Its IUPAC name is 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| PubChem CID | 63024843 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| SMILES | O=S(=O)(C1CCCNC1)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C11H18N4O2S/c16-18(17,10-2-1-3-12-8-10)15-7-6-14-5-4-13-11(14)9-15/h4-5,10,12H,1-3,6-9H2 |
| InChIKey | NDLUAYSPUBQECX-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The IUPAC name of 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (CID 63024843) is 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
What is the SMILES notation for 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The canonical SMILES for 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is O=S(=O)(C1CCCNC1)N1CCn2ccnc2C1.
What is the InChIKey of 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The InChIKey is NDLUAYSPUBQECX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2S/c16-18(17,10-2-1-3-12-8-10)15-7-6-14-5-4-13-11(14)9-15/h4-5,10,12H,1-3,6-9H2.
What are the key properties of 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine has a molecular weight of 270.36 g/mol, XLogP of -0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-piperidin-3-ylsulfonyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is sourced from PubChem (CID 63024843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).