About Indazol-4-amine, 6-nitro-1,N-diphenyl-
Indazol-4-amine, 6-nitro-1,N-diphenyl- (PubChem CID 630249) has the molecular formula C19H14N4O2
and a molecular weight of 330.30 g/mol. Its IUPAC name is 6-nitro-N,1-diphenylindazol-4-amine.
Molecular Properties
| Compound Name | Indazol-4-amine, 6-nitro-1,N-diphenyl- |
| PubChem CID | 630249 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 6-nitro-N,1-diphenylindazol-4-amine |
| SMILES | C1=CC=C(C=C1)NC2=C3C=NN(C3=CC(=C2)[N+](=O)[O-])C4=CC=CC=C4 |
| InChI | InChI=1S/C19H14N4O2/c24-23(25)16-11-18(21-14-7-3-1-4-8-14)17-13-20-22(19(17)12-16)15-9-5-2-6-10-15/h1-13,21H |
| InChIKey | CEUNCVVLMQFKIU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | 457 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Indazol-4-amine, 6-nitro-1,N-diphenyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Indazol-4-amine, 6-nitro-1,N-diphenyl-?
The IUPAC name of Indazol-4-amine, 6-nitro-1,N-diphenyl- (CID 630249) is 6-nitro-N,1-diphenylindazol-4-amine.
What is the SMILES notation for Indazol-4-amine, 6-nitro-1,N-diphenyl-?
The canonical SMILES for Indazol-4-amine, 6-nitro-1,N-diphenyl- is C1=CC=C(C=C1)NC2=C3C=NN(C3=CC(=C2)[N+](=O)[O-])C4=CC=CC=C4.
What is the InChIKey of Indazol-4-amine, 6-nitro-1,N-diphenyl-?
The InChIKey is CEUNCVVLMQFKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4O2/c24-23(25)16-11-18(21-14-7-3-1-4-8-14)17-13-20-22(19(17)12-16)15-9-5-2-6-10-15/h1-13,21H.
What are the key properties of Indazol-4-amine, 6-nitro-1,N-diphenyl-?
Indazol-4-amine, 6-nitro-1,N-diphenyl- has a molecular weight of 330.30 g/mol, XLogP of 4.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Indazol-4-amine, 6-nitro-1,N-diphenyl- is sourced from PubChem (CID 630249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).