About 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine
3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine (PubChem CID 63026444) has the molecular formula C16H17FN4
and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine.
Molecular Properties
| Compound Name | 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine |
| PubChem CID | 63026444 |
| Molecular Formula | C16H17FN4 |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccc(CN2CCn3ccnc3C2)c(F)c1 |
| InChI | InChI=1S/C16H17FN4/c17-15-10-13(2-1-5-18)3-4-14(15)11-20-8-9-21-7-6-19-16(21)12-20/h3-4,6-7,10H,5,8-9,11-12,18H2 |
| InChIKey | YCKTVLARRHVSJJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine?
The IUPAC name of 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine (CID 63026444) is 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine.
What is the SMILES notation for 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine?
The canonical SMILES for 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine is NCC#Cc1ccc(CN2CCn3ccnc3C2)c(F)c1.
What is the InChIKey of 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine?
The InChIKey is YCKTVLARRHVSJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN4/c17-15-10-13(2-1-5-18)3-4-14(15)11-20-8-9-21-7-6-19-16(21)12-20/h3-4,6-7,10H,5,8-9,11-12,18H2.
What are the key properties of 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine?
3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine has a molecular weight of 284.34 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-3-fluorophenyl]prop-2-yn-1-amine is sourced from PubChem (CID 63026444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).