C14H27N3O — CID 63027338
4-[ethyl(oxolan-2-ylmethyl)amino]-2-(propan-2-ylamino)butanenitrile (PubChem CID 63027338) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-[ethyl(oxolan-2-ylmethyl)amino]-2-(propan-2-ylamino)butanenitrile.
| Compound Name | 4-[ethyl(oxolan-2-ylmethyl)amino]-2-(propan-2-ylamino)butanenitrile |
|---|---|
| PubChem CID | 63027338 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 4-[ethyl(oxolan-2-ylmethyl)amino]-2-(propan-2-ylamino)butanenitrile |
| SMILES | CCN(CCC(C#N)NC(C)C)CC1CCCO1 |
| InChI | InChI=1S/C14H27N3O/c1-4-17(11-14-6-5-9-18-14)8-7-13(10-15)16-12(2)3/h12-14,16H,4-9,11H2,1-3H3 |
| InChIKey | MZMUBHNOZJQZAJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |