C16H27N3O2 — CID 63027374
methyl 4-[methyl(2-pyridin-2-ylethyl)amino]-2-(propylamino)butanoate (PubChem CID 63027374) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is methyl 4-[methyl(2-pyridin-2-ylethyl)amino]-2-(propylamino)butanoate.
| Compound Name | methyl 4-[methyl(2-pyridin-2-ylethyl)amino]-2-(propylamino)butanoate |
|---|---|
| PubChem CID | 63027374 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | methyl 4-[methyl(2-pyridin-2-ylethyl)amino]-2-(propylamino)butanoate |
| SMILES | CCCNC(CCN(C)CCc1ccccn1)C(=O)OC |
| InChI | InChI=1S/C16H27N3O2/c1-4-10-18-15(16(20)21-3)9-13-19(2)12-8-14-7-5-6-11-17-14/h5-7,11,15,18H,4,8-10,12-13H2,1-3H3 |
| InChIKey | VQLYNUMDNCANJK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |