About 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile
2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile (PubChem CID 63028844) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile.
Molecular Properties
| Compound Name | 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile |
| PubChem CID | 63028844 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile |
| SMILES | CCCNC(C#N)CCOc1c(C)ccc(C)c1C |
| InChI | InChI=1S/C16H24N2O/c1-5-9-18-15(11-17)8-10-19-16-13(3)7-6-12(2)14(16)4/h6-7,15,18H,5,8-10H2,1-4H3 |
| InChIKey | POGZIPASZUKJGS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile?
The IUPAC name of 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile (CID 63028844) is 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile.
What is the SMILES notation for 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile?
The canonical SMILES for 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile is CCCNC(C#N)CCOc1c(C)ccc(C)c1C.
What is the InChIKey of 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile?
The InChIKey is POGZIPASZUKJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-5-9-18-15(11-17)8-10-19-16-13(3)7-6-12(2)14(16)4/h6-7,15,18H,5,8-10H2,1-4H3.
What are the key properties of 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile?
2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile has a molecular weight of 260.38 g/mol, XLogP of 3.27, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propylamino)-4-(2,3,6-trimethylphenoxy)butanenitrile is sourced from PubChem (CID 63028844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).