C21H27FO4 — CID 630294
9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 630294) has the molecular formula C21H27FO4 and a molecular weight of 362.44 g/mol. Its IUPAC name is 9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 630294 |
| Molecular Formula | C21H27FO4 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12CC(O)C3(F)C(CCC4=CC(=O)CCC43C)C1CC=C2C(=O)CO |
| InChI | InChI=1S/C21H27FO4/c1-19-10-18(26)21(22)15(14(19)5-6-16(19)17(25)11-23)4-3-12-9-13(24)7-8-20(12,21)2/h6,9,14-15,18,23,26H,3-5,7-8,10-11H2,1-2H3 |
| InChIKey | JYRZUFLFOVQDGZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |