C10H14F3NO4 — CID 63030408
1-[3-(2,2,2-trifluoroethoxy)propanoyl]pyrrolidine-3-carboxylic acid (PubChem CID 63030408) has the molecular formula C10H14F3NO4 and a molecular weight of 269.22 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propanoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propanoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63030408 |
| Molecular Formula | C10H14F3NO4 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propanoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)CCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H14F3NO4/c11-10(12,13)6-18-4-2-8(15)14-3-1-7(5-14)9(16)17/h7H,1-6H2,(H,16,17) |
| InChIKey | BZUSMONJCGPSGK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|