C13H16N2O3 — CID 63030537
1-[2-(4-aminophenyl)acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 63030537) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-[2-(4-aminophenyl)acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-(4-aminophenyl)acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63030537 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-[2-(4-aminophenyl)acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | Nc1ccc(CC(=O)N2CCC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C13H16N2O3/c14-11-3-1-9(2-4-11)7-12(16)15-6-5-10(8-15)13(17)18/h1-4,10H,5-8,14H2,(H,17,18) |
| InChIKey | YXRIGHUYLKAWPL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|