About 2-pyrrolidin-3-yl-1,3-benzoxazole
2-pyrrolidin-3-yl-1,3-benzoxazole (PubChem CID 63032537) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-pyrrolidin-3-yl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-pyrrolidin-3-yl-1,3-benzoxazole |
| PubChem CID | 63032537 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-pyrrolidin-3-yl-1,3-benzoxazole |
| SMILES | c1ccc2oc(C3CCNC3)nc2c1 |
| InChI | InChI=1S/C11H12N2O/c1-2-4-10-9(3-1)13-11(14-10)8-5-6-12-7-8/h1-4,8,12H,5-7H2 |
| InChIKey | JNQZNLFYFBJNEC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrrolidin-3-yl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-3-yl-1,3-benzoxazole?
The IUPAC name of 2-pyrrolidin-3-yl-1,3-benzoxazole (CID 63032537) is 2-pyrrolidin-3-yl-1,3-benzoxazole.
What is the SMILES notation for 2-pyrrolidin-3-yl-1,3-benzoxazole?
The canonical SMILES for 2-pyrrolidin-3-yl-1,3-benzoxazole is c1ccc2oc(C3CCNC3)nc2c1.
What is the InChIKey of 2-pyrrolidin-3-yl-1,3-benzoxazole?
The InChIKey is JNQZNLFYFBJNEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-2-4-10-9(3-1)13-11(14-10)8-5-6-12-7-8/h1-4,8,12H,5-7H2.
What are the key properties of 2-pyrrolidin-3-yl-1,3-benzoxazole?
2-pyrrolidin-3-yl-1,3-benzoxazole has a molecular weight of 188.23 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-3-yl-1,3-benzoxazole is sourced from PubChem (CID 63032537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).