1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid

C9H15NO6S2 — CID 63032880

IUPAC1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(S(=O)(=O)C2CCS(=O)(=O)C2)C1
InChIInChI=1S/C9H15NO6S2/c11-9(12)7-1-3-10(5-7)18(15,16)8-2-4-17(13,14)6-8/h7-8H,1-6H2,(H,11,12)
InChIKeyKYNYJHLEOGXNBR-UHFFFAOYSA-N
MW297.35 g/mol
LogP-1.09
Rot. Bonds3

About 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid

1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid (PubChem CID 63032880) has the molecular formula C9H15NO6S2 and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid
PubChem CID63032880
Molecular FormulaC9H15NO6S2
Molecular Weight297.35 g/mol
Exact Mass297.03
IUPAC Name1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(S(=O)(=O)C2CCS(=O)(=O)C2)C1
InChIInChI=1S/C9H15NO6S2/c11-9(12)7-1-3-10(5-7)18(15,16)8-2-4-17(13,14)6-8/h7-8H,1-6H2,(H,11,12)
InChIKeyKYNYJHLEOGXNBR-UHFFFAOYSA-N
XLogP-1.09
TPSA108.82 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.35
LogP ≤ 5-1.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid (CID 63032880) is 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid is O=C(O)C1CCN(S(=O)(=O)C2CCS(=O)(=O)C2)C1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid?
The InChIKey is KYNYJHLEOGXNBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO6S2/c11-9(12)7-1-3-10(5-7)18(15,16)8-2-4-17(13,14)6-8/h7-8H,1-6H2,(H,11,12).
What are the key properties of 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid?
1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid has a molecular weight of 297.35 g/mol, XLogP of -1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)sulfonylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 63032880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).