About 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene
4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene (PubChem CID 63034207) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene.
Analyze 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene?
The IUPAC name of 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene (CID 63034207) is 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene.
What is the SMILES notation for 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene?
The canonical SMILES for 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene is C1Cn2c(nc3c2COCC3)CN1.
What is the InChIKey of 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene?
The InChIKey is BSGSMTLOYIADAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-4-13-6-8-7(1)11-9-5-10-2-3-12(8)9/h10H,1-6H2.
What are the key properties of 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene?
4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene has a molecular weight of 179.22 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxa-1,8,11-triazatricyclo[7.4.0.02,7]trideca-2(7),8-diene is sourced from PubChem (CID 63034207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).