C11H24N2OS — CID 63034299
4-butan-2-ylsulfanyl-2-(propan-2-ylamino)butanamide (PubChem CID 63034299) has the molecular formula C11H24N2OS and a molecular weight of 232.39 g/mol. Its IUPAC name is 4-butan-2-ylsulfanyl-2-(propan-2-ylamino)butanamide.
| Compound Name | 4-butan-2-ylsulfanyl-2-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 63034299 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 4-butan-2-ylsulfanyl-2-(propan-2-ylamino)butanamide |
| SMILES | CCC(C)SCCC(NC(C)C)C(N)=O |
| InChI | InChI=1S/C11H24N2OS/c1-5-9(4)15-7-6-10(11(12)14)13-8(2)3/h8-10,13H,5-7H2,1-4H3,(H2,12,14) |
| InChIKey | NHJOGWQAMUVREF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |