About 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene
2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene (PubChem CID 63034720) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene.
Analyze 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene?
The IUPAC name of 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene (CID 63034720) is 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene.
What is the SMILES notation for 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene?
The canonical SMILES for 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene is C1CCc2nc3n(c2CC1)CCNC3.
What is the InChIKey of 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene?
The InChIKey is PZGUWSYYAYWJTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-2-4-9-10(5-3-1)14-7-6-12-8-11(14)13-9/h12H,1-8H2.
What are the key properties of 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene?
2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene has a molecular weight of 191.28 g/mol, XLogP of 1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),7-diene is sourced from PubChem (CID 63034720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).