About ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate
ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate (PubChem CID 63035411) has the molecular formula C12H21N3O3S
and a molecular weight of 287.38 g/mol. Its IUPAC name is ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate.
Molecular Properties
| Compound Name | ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate |
| PubChem CID | 63035411 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate |
| SMILES | CCCNC(CCSc1nnc(C)o1)C(=O)OCC |
| InChI | InChI=1S/C12H21N3O3S/c1-4-7-13-10(11(16)17-5-2)6-8-19-12-15-14-9(3)18-12/h10,13H,4-8H2,1-3H3 |
| InChIKey | BEEGNMGSETUDOD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate?
The IUPAC name of ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate (CID 63035411) is ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate.
What is the SMILES notation for ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate?
The canonical SMILES for ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate is CCCNC(CCSc1nnc(C)o1)C(=O)OCC.
What is the InChIKey of ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate?
The InChIKey is BEEGNMGSETUDOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3S/c1-4-7-13-10(11(16)17-5-2)6-8-19-12-15-14-9(3)18-12/h10,13H,4-8H2,1-3H3.
What are the key properties of ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate?
ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate has a molecular weight of 287.38 g/mol, XLogP of 1.79, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-(propylamino)butanoate is sourced from PubChem (CID 63035411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).