C16H19F2NO2 — CID 63036291
N-[[5-[(2,3-difluorophenoxy)methyl]-2-methylfuran-3-yl]methyl]propan-1-amine (PubChem CID 63036291) has the molecular formula C16H19F2NO2 and a molecular weight of 295.33 g/mol. Its IUPAC name is N-[[5-[(2,3-difluorophenoxy)methyl]-2-methylfuran-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-[(2,3-difluorophenoxy)methyl]-2-methylfuran-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63036291 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[[5-[(2,3-difluorophenoxy)methyl]-2-methylfuran-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(COc2cccc(F)c2F)oc1C |
| InChI | InChI=1S/C16H19F2NO2/c1-3-7-19-9-12-8-13(21-11(12)2)10-20-15-6-4-5-14(17)16(15)18/h4-6,8,19H,3,7,9-10H2,1-2H3 |
| InChIKey | KNBPMIZFOJJZTH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|