C15H20F2N2O — CID 63036442
5-(2,3-difluorophenoxy)-2-methyl-2-(propan-2-ylamino)pentanenitrile (PubChem CID 63036442) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is 5-(2,3-difluorophenoxy)-2-methyl-2-(propan-2-ylamino)pentanenitrile.
| Compound Name | 5-(2,3-difluorophenoxy)-2-methyl-2-(propan-2-ylamino)pentanenitrile |
|---|---|
| PubChem CID | 63036442 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5-(2,3-difluorophenoxy)-2-methyl-2-(propan-2-ylamino)pentanenitrile |
| SMILES | CC(C)NC(C)(C#N)CCCOc1cccc(F)c1F |
| InChI | InChI=1S/C15H20F2N2O/c1-11(2)19-15(3,10-18)8-5-9-20-13-7-4-6-12(16)14(13)17/h4,6-7,11,19H,5,8-9H2,1-3H3 |
| InChIKey | JPZGYOBMGDXJIC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|