C14H10F3NO3 — CID 63036791
methyl 2-amino-5-(2,3-difluorophenoxy)-4-fluorobenzoate (PubChem CID 63036791) has the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. Its IUPAC name is methyl 2-amino-5-(2,3-difluorophenoxy)-4-fluorobenzoate.
| Compound Name | methyl 2-amino-5-(2,3-difluorophenoxy)-4-fluorobenzoate |
|---|---|
| PubChem CID | 63036791 |
| Molecular Formula | C14H10F3NO3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | methyl 2-amino-5-(2,3-difluorophenoxy)-4-fluorobenzoate |
| SMILES | COC(=O)c1cc(Oc2cccc(F)c2F)c(F)cc1N |
| InChI | InChI=1S/C14H10F3NO3/c1-20-14(19)7-5-12(9(16)6-10(7)18)21-11-4-2-3-8(15)13(11)17/h2-6H,18H2,1H3 |
| InChIKey | OPUGNBBSTNCROE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|