C18H28N4O2 — CID 630374
5,9,14,18-tetramethyl-1,4,10,13-tetrazacyclooctadeca-4,9,13,18-tetraene-7,16-dione (PubChem CID 630374) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 5,9,14,18-tetramethyl-1,4,10,13-tetrazacyclooctadeca-4,9,13,18-tetraene-7,16-dione.
| Compound Name | 5,9,14,18-tetramethyl-1,4,10,13-tetrazacyclooctadeca-4,9,13,18-tetraene-7,16-dione |
|---|---|
| PubChem CID | 630374 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 5,9,14,18-tetramethyl-1,4,10,13-tetrazacyclooctadeca-4,9,13,18-tetraene-7,16-dione |
| SMILES | C/C1=N\CC/N=C(\C)CC(=O)C/C(C)=N/CC/N=C(\C)CC(=O)C1 |
| InChI | InChI=1S/C18H28N4O2/c1-13-9-17(23)10-14(2)21-7-8-22-16(4)12-18(24)11-15(3)20-6-5-19-13/h5-12H2,1-4H3/b19-13+,20-15+,21-14+,22-16+ |
| InChIKey | AIDRLNNCSWUZCQ-GJQKUNNFSA-N |
| XLogP | 2.54 |
| TPSA | 83.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |