About N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide
N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide (PubChem CID 63037740) has the molecular formula C6H7N3O2S
and a molecular weight of 185.21 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 63037740 |
| Molecular Formula | C6H7N3O2S |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)CNC(=O)c1cscn1 |
| InChI | InChI=1S/C6H7N3O2S/c7-5(10)1-8-6(11)4-2-12-3-9-4/h2-3H,1H2,(H2,7,10)(H,8,11) |
| InChIKey | UYYGLQFHURBWIW-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide (CID 63037740) is N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide is NC(=O)CNC(=O)c1cscn1.
What is the InChIKey of N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide?
The InChIKey is UYYGLQFHURBWIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2S/c7-5(10)1-8-6(11)4-2-12-3-9-4/h2-3H,1H2,(H2,7,10)(H,8,11).
What are the key properties of N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide?
N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide has a molecular weight of 185.21 g/mol, XLogP of -0.64, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-oxoethyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 63037740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).