C16H10F6O — CID 630389
9-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-9H-fluorene (PubChem CID 630389) has the molecular formula C16H10F6O and a molecular weight of 332.24 g/mol. Its IUPAC name is 9-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-9H-fluorene.
| Compound Name | 9-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-9H-fluorene |
|---|---|
| PubChem CID | 630389 |
| Molecular Formula | C16H10F6O |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 9-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-9H-fluorene |
| SMILES | FC(F)(F)C(OC1c2ccccc2-c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C16H10F6O/c17-15(18,19)14(16(20,21)22)23-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H |
| InChIKey | TZPGVUOVPJQJMV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |