C13H19N3O5 — CID 63039034
2-(ethylamino)-4-(4-methoxy-2-nitrophenoxy)butanamide (PubChem CID 63039034) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(ethylamino)-4-(4-methoxy-2-nitrophenoxy)butanamide.
| Compound Name | 2-(ethylamino)-4-(4-methoxy-2-nitrophenoxy)butanamide |
|---|---|
| PubChem CID | 63039034 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(ethylamino)-4-(4-methoxy-2-nitrophenoxy)butanamide |
| SMILES | CCNC(CCOc1ccc(OC)cc1[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C13H19N3O5/c1-3-15-10(13(14)17)6-7-21-12-5-4-9(20-2)8-11(12)16(18)19/h4-5,8,10,15H,3,6-7H2,1-2H3,(H2,14,17) |
| InChIKey | WQFDNFFKZHIVQO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|