C22H19NO3S — CID 6304047
N-[(E)-1-(benzenesulfonyl)-2-phenylethenyl]-4-methylbenzamide (PubChem CID 6304047) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[(E)-1-(benzenesulfonyl)-2-phenylethenyl]-4-methylbenzamide.
| Compound Name | N-[(E)-1-(benzenesulfonyl)-2-phenylethenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 6304047 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[(E)-1-(benzenesulfonyl)-2-phenylethenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=C\c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19NO3S/c1-17-12-14-19(15-13-17)22(24)23-21(16-18-8-4-2-5-9-18)27(25,26)20-10-6-3-7-11-20/h2-16H,1H3,(H,23,24)/b21-16+ |
| InChIKey | DMVKHVUNBZBQER-LTGZKZEYSA-N |
| XLogP | 4.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |