C15H20F2N2O — CID 63043413
3-amino-N-[1-(2,4-difluorophenyl)ethyl]cyclohexane-1-carboxamide (PubChem CID 63043413) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is 3-amino-N-[1-(2,4-difluorophenyl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[1-(2,4-difluorophenyl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 63043413 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-amino-N-[1-(2,4-difluorophenyl)ethyl]cyclohexane-1-carboxamide |
| SMILES | CC(NC(=O)C1CCCC(N)C1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H20F2N2O/c1-9(13-6-5-11(16)8-14(13)17)19-15(20)10-3-2-4-12(18)7-10/h5-6,8-10,12H,2-4,7,18H2,1H3,(H,19,20) |
| InChIKey | DYBZAQYBATUROB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |