About 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine
3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine (PubChem CID 63046479) has the molecular formula C15H17Cl2N3
and a molecular weight of 310.23 g/mol. Its IUPAC name is 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine |
| PubChem CID | 63046479 |
| Molecular Formula | C15H17Cl2N3 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine |
| SMILES | NC1CCCC(c2ncc(-c3cc(Cl)ccc3Cl)[nH]2)C1 |
| InChI | InChI=1S/C15H17Cl2N3/c16-10-4-5-13(17)12(7-10)14-8-19-15(20-14)9-2-1-3-11(18)6-9/h4-5,7-9,11H,1-3,6,18H2,(H,19,20) |
| InChIKey | GIAPWLWSLVZMFT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine?
The IUPAC name of 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine (CID 63046479) is 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine.
What is the SMILES notation for 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine?
The canonical SMILES for 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine is NC1CCCC(c2ncc(-c3cc(Cl)ccc3Cl)[nH]2)C1.
What is the InChIKey of 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine?
The InChIKey is GIAPWLWSLVZMFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl2N3/c16-10-4-5-13(17)12(7-10)14-8-19-15(20-14)9-2-1-3-11(18)6-9/h4-5,7-9,11H,1-3,6,18H2,(H,19,20).
What are the key properties of 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine?
3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine has a molecular weight of 310.23 g/mol, XLogP of 4.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,5-dichlorophenyl)-1H-imidazol-2-yl]cyclohexan-1-amine is sourced from PubChem (CID 63046479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).