C10H14F3N3 — CID 63046647
3-[5-(trifluoromethyl)-1H-imidazol-2-yl]cyclohexan-1-amine (PubChem CID 63046647) has the molecular formula C10H14F3N3 and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-[5-(trifluoromethyl)-1H-imidazol-2-yl]cyclohexan-1-amine.
| Compound Name | 3-[5-(trifluoromethyl)-1H-imidazol-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 63046647 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-[5-(trifluoromethyl)-1H-imidazol-2-yl]cyclohexan-1-amine |
| SMILES | NC1CCCC(c2ncc(C(F)(F)F)[nH]2)C1 |
| InChI | InChI=1S/C10H14F3N3/c11-10(12,13)8-5-15-9(16-8)6-2-1-3-7(14)4-6/h5-7H,1-4,14H2,(H,15,16) |
| InChIKey | HGAQEFRXUHLEDU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |