C15H25BrN2O — CID 63047104
2-bromo-4-[[[1-(dimethylamino)-4-methylpentan-2-yl]amino]methyl]phenol (PubChem CID 63047104) has the molecular formula C15H25BrN2O and a molecular weight of 329.28 g/mol. Its IUPAC name is 2-bromo-4-[[[1-(dimethylamino)-4-methylpentan-2-yl]amino]methyl]phenol.
| Compound Name | 2-bromo-4-[[[1-(dimethylamino)-4-methylpentan-2-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 63047104 |
| Molecular Formula | C15H25BrN2O |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-bromo-4-[[[1-(dimethylamino)-4-methylpentan-2-yl]amino]methyl]phenol |
| SMILES | CC(C)CC(CN(C)C)NCc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C15H25BrN2O/c1-11(2)7-13(10-18(3)4)17-9-12-5-6-15(19)14(16)8-12/h5-6,8,11,13,17,19H,7,9-10H2,1-4H3 |
| InChIKey | GOFBBYGMHCJBOB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |