C10H11N3S — CID 63048501
N-cyclopropyl-5-thiophen-3-yl-1H-pyrazol-3-amine (PubChem CID 63048501) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is N-cyclopropyl-5-thiophen-3-yl-1H-pyrazol-3-amine.
| Compound Name | N-cyclopropyl-5-thiophen-3-yl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 63048501 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | N-cyclopropyl-5-thiophen-3-yl-1H-pyrazol-3-amine |
| SMILES | c1cc(-c2cc(NC3CC3)n[nH]2)cs1 |
| InChI | InChI=1S/C10H11N3S/c1-2-8(1)11-10-5-9(12-13-10)7-3-4-14-6-7/h3-6,8H,1-2H2,(H2,11,12,13) |
| InChIKey | GROMZJPWMIZBHI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |