C9H8FN3O — CID 63048941
5-(5-fluoro-2-methylphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 63048941) has the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. Its IUPAC name is 5-(5-fluoro-2-methylphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(5-fluoro-2-methylphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 63048941 |
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-(5-fluoro-2-methylphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Cc1ccc(F)cc1-c1nnc(N)o1 |
| InChI | InChI=1S/C9H8FN3O/c1-5-2-3-6(10)4-7(5)8-12-13-9(11)14-8/h2-4H,1H3,(H2,11,13) |
| InChIKey | FYADMHIGMTXZII-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |