About N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine
N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine (PubChem CID 63049032) has the molecular formula C13H15F2N3
and a molecular weight of 251.28 g/mol. Its IUPAC name is N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine |
| PubChem CID | 63049032 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine |
| SMILES | CC(C)(C)Nc1cc(-c2c(F)cccc2F)[nH]n1 |
| InChI | InChI=1S/C13H15F2N3/c1-13(2,3)16-11-7-10(17-18-11)12-8(14)5-4-6-9(12)15/h4-7H,1-3H3,(H2,16,17,18) |
| InChIKey | BYJYFTCKWVFCGS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine?
The IUPAC name of N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine (CID 63049032) is N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine.
What is the SMILES notation for N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine?
The canonical SMILES for N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine is CC(C)(C)Nc1cc(-c2c(F)cccc2F)[nH]n1.
What is the InChIKey of N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine?
The InChIKey is BYJYFTCKWVFCGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2N3/c1-13(2,3)16-11-7-10(17-18-11)12-8(14)5-4-6-9(12)15/h4-7H,1-3H3,(H2,16,17,18).
What are the key properties of N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine?
N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine has a molecular weight of 251.28 g/mol, XLogP of 3.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-5-(2,6-difluorophenyl)-1H-pyrazol-3-amine is sourced from PubChem (CID 63049032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).