C15H22F3N3 — CID 63050917
N-methyl-N-(1-methylpiperidin-4-yl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine (PubChem CID 63050917) has the molecular formula C15H22F3N3 and a molecular weight of 301.36 g/mol. Its IUPAC name is N-methyl-N-(1-methylpiperidin-4-yl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine.
| Compound Name | N-methyl-N-(1-methylpiperidin-4-yl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63050917 |
| Molecular Formula | C15H22F3N3 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-methyl-N-(1-methylpiperidin-4-yl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine |
| SMILES | CN1CCC(N(C)C(CN)c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H22F3N3/c1-20-5-3-11(4-6-20)21(2)14(9-19)10-7-12(16)15(18)13(17)8-10/h7-8,11,14H,3-6,9,19H2,1-2H3 |
| InChIKey | PUJNUKLEXZLWAQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|