C15H20F3NO — CID 63051065
[3-methyl-1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]methanol (PubChem CID 63051065) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is [3-methyl-1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]methanol.
| Compound Name | [3-methyl-1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 63051065 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [3-methyl-1-[(3,4,5-trifluorophenyl)methylamino]cyclohexyl]methanol |
| SMILES | CC1CCCC(CO)(NCc2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H20F3NO/c1-10-3-2-4-15(7-10,9-20)19-8-11-5-12(16)14(18)13(17)6-11/h5-6,10,19-20H,2-4,7-9H2,1H3 |
| InChIKey | YZNVYGFNDDXRLG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|