About 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline
2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline (PubChem CID 63051923) has the molecular formula C14H22F2N2
and a molecular weight of 256.34 g/mol. Its IUPAC name is 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline.
Molecular Properties
| Compound Name | 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline |
| PubChem CID | 63051923 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1c(F)cc(CNC)cc1F |
| InChI | InChI=1S/C14H22F2N2/c1-4-6-18(7-5-2)14-12(15)8-11(10-17-3)9-13(14)16/h8-9,17H,4-7,10H2,1-3H3 |
| InChIKey | ZTLFGIMEDQMJCV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline?
The IUPAC name of 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline (CID 63051923) is 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline.
What is the SMILES notation for 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline?
The canonical SMILES for 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline is CCCN(CCC)c1c(F)cc(CNC)cc1F.
What is the InChIKey of 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline?
The InChIKey is ZTLFGIMEDQMJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2N2/c1-4-6-18(7-5-2)14-12(15)8-11(10-17-3)9-13(14)16/h8-9,17H,4-7,10H2,1-3H3.
What are the key properties of 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline?
2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline has a molecular weight of 256.34 g/mol, XLogP of 3.31, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-4-(methylaminomethyl)-N,N-dipropylaniline is sourced from PubChem (CID 63051923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).