About N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline
N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline (PubChem CID 63051956) has the molecular formula C15H22F2N2
and a molecular weight of 268.35 g/mol. Its IUPAC name is N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline.
Molecular Properties
| Compound Name | N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline |
| PubChem CID | 63051956 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline |
| SMILES | CCN(c1c(F)cc(CNC(C)C)cc1F)C1CC1 |
| InChI | InChI=1S/C15H22F2N2/c1-4-19(12-5-6-12)15-13(16)7-11(8-14(15)17)9-18-10(2)3/h7-8,10,12,18H,4-6,9H2,1-3H3 |
| InChIKey | JADSGZWHENMYOC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline?
The IUPAC name of N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline (CID 63051956) is N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline.
What is the SMILES notation for N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline?
The canonical SMILES for N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline is CCN(c1c(F)cc(CNC(C)C)cc1F)C1CC1.
What is the InChIKey of N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline?
The InChIKey is JADSGZWHENMYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F2N2/c1-4-19(12-5-6-12)15-13(16)7-11(8-14(15)17)9-18-10(2)3/h7-8,10,12,18H,4-6,9H2,1-3H3.
What are the key properties of N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline?
N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline has a molecular weight of 268.35 g/mol, XLogP of 3.45, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-ethyl-2,6-difluoro-4-[(propan-2-ylamino)methyl]aniline is sourced from PubChem (CID 63051956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).