C14H21F3N2O2 — CID 63052111
N,N-bis(2-methoxyethyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine (PubChem CID 63052111) has the molecular formula C14H21F3N2O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine.
| Compound Name | N,N-bis(2-methoxyethyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63052111 |
| Molecular Formula | C14H21F3N2O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine |
| SMILES | COCCN(CCOC)C(CN)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H21F3N2O2/c1-20-5-3-19(4-6-21-2)13(9-18)10-7-11(15)14(17)12(16)8-10/h7-8,13H,3-6,9,18H2,1-2H3 |
| InChIKey | SACVSTLQYKENTG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|