C14H19F3N2O — CID 63052460
N-methyl-N-(oxolan-2-ylmethyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine (PubChem CID 63052460) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is N-methyl-N-(oxolan-2-ylmethyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine.
| Compound Name | N-methyl-N-(oxolan-2-ylmethyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63052460 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-methyl-N-(oxolan-2-ylmethyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine |
| SMILES | CN(CC1CCCO1)C(CN)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H19F3N2O/c1-19(8-10-3-2-4-20-10)13(7-18)9-5-11(15)14(17)12(16)6-9/h5-6,10,13H,2-4,7-8,18H2,1H3 |
| InChIKey | AFNWTHWJLVUXQS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|